C19H13BrClN5O4 — CID 136507476
2-(3-bromo-4-hydroxy-5-methoxyphenyl)-9-(4-chlorophenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 136507476) has the molecular formula C19H13BrClN5O4 and a molecular weight of 490.70 g/mol. Its IUPAC name is 2-(3-bromo-4-hydroxy-5-methoxyphenyl)-9-(4-chlorophenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 2-(3-bromo-4-hydroxy-5-methoxyphenyl)-9-(4-chlorophenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 136507476 |
| Molecular Formula | C19H13BrClN5O4 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 488.98 |
| IUPAC Name | 2-(3-bromo-4-hydroxy-5-methoxyphenyl)-9-(4-chlorophenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | COc1cc(-c2nc(C(N)=O)c3[nH]c(=O)n(-c4ccc(Cl)cc4)c3n2)cc(Br)c1O |
| InChI | InChI=1S/C19H13BrClN5O4/c1-30-12-7-8(6-11(20)15(12)27)17-23-13(16(22)28)14-18(25-17)26(19(29)24-14)10-4-2-9(21)3-5-10/h2-7,27H,1H3,(H2,22,28)(H,24,29) |
| InChIKey | UBHGJLWFUOPMEY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |