C20H15Cl2N5O3 — CID 16815160
9-(3,4-dichlorophenyl)-2-(4-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 16815160) has the molecular formula C20H15Cl2N5O3 and a molecular weight of 444.28 g/mol. Its IUPAC name is 9-(3,4-dichlorophenyl)-2-(4-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 9-(3,4-dichlorophenyl)-2-(4-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 16815160 |
| Molecular Formula | C20H15Cl2N5O3 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 9-(3,4-dichlorophenyl)-2-(4-ethoxyphenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C(N)=O)c3[nH]c(=O)n(-c4ccc(Cl)c(Cl)c4)c3n2)cc1 |
| InChI | InChI=1S/C20H15Cl2N5O3/c1-2-30-12-6-3-10(4-7-12)18-24-15(17(23)28)16-19(26-18)27(20(29)25-16)11-5-8-13(21)14(22)9-11/h3-9H,2H2,1H3,(H2,23,28)(H,25,29) |
| InChIKey | XJUAZAQHJLLYGL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |