C22H21N5O2S — CID 130340425
2-(4-ethoxyphenyl)-9-(4-ethylphenyl)-8-sulfanylidene-7H-purine-6-carboxamide (PubChem CID 130340425) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-9-(4-ethylphenyl)-8-sulfanylidene-7H-purine-6-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-9-(4-ethylphenyl)-8-sulfanylidene-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 130340425 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 2-(4-ethoxyphenyl)-9-(4-ethylphenyl)-8-sulfanylidene-7H-purine-6-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C(N)=O)c3[nH]c(=S)n(-c4ccc(CC)cc4)c3n2)cc1 |
| InChI | InChI=1S/C22H21N5O2S/c1-3-13-5-9-15(10-6-13)27-21-18(25-22(27)30)17(19(23)28)24-20(26-21)14-7-11-16(12-8-14)29-4-2/h5-12H,3-4H2,1-2H3,(H2,23,28)(H,25,30) |
| InChIKey | VGIWYXBXPJPTKU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|