C21H18FN5O3 — CID 53088237
2-(4-ethoxyphenyl)-9-(4-fluorophenyl)-7-methyl-8-oxopurine-6-carboxamide (PubChem CID 53088237) has the molecular formula C21H18FN5O3 and a molecular weight of 407.41 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-9-(4-fluorophenyl)-7-methyl-8-oxopurine-6-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-9-(4-fluorophenyl)-7-methyl-8-oxopurine-6-carboxamide |
|---|---|
| PubChem CID | 53088237 |
| Molecular Formula | C21H18FN5O3 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-(4-ethoxyphenyl)-9-(4-fluorophenyl)-7-methyl-8-oxopurine-6-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C(N)=O)c3c(n2)n(-c2ccc(F)cc2)c(=O)n3C)cc1 |
| InChI | InChI=1S/C21H18FN5O3/c1-3-30-15-10-4-12(5-11-15)19-24-16(18(23)28)17-20(25-19)27(21(29)26(17)2)14-8-6-13(22)7-9-14/h4-11H,3H2,1-2H3,(H2,23,28) |
| InChIKey | LFJYIYYIHSXAGO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |