C22H18FN5O4 — CID 53088200
methyl 4-[6-carbamoyl-7-ethyl-9-(4-fluorophenyl)-8-oxopurin-2-yl]benzoate (PubChem CID 53088200) has the molecular formula C22H18FN5O4 and a molecular weight of 435.42 g/mol. Its IUPAC name is methyl 4-[6-carbamoyl-7-ethyl-9-(4-fluorophenyl)-8-oxopurin-2-yl]benzoate.
| Compound Name | methyl 4-[6-carbamoyl-7-ethyl-9-(4-fluorophenyl)-8-oxopurin-2-yl]benzoate |
|---|---|
| PubChem CID | 53088200 |
| Molecular Formula | C22H18FN5O4 |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | methyl 4-[6-carbamoyl-7-ethyl-9-(4-fluorophenyl)-8-oxopurin-2-yl]benzoate |
| SMILES | CCn1c(=O)n(-c2ccc(F)cc2)c2nc(-c3ccc(C(=O)OC)cc3)nc(C(N)=O)c21 |
| InChI | InChI=1S/C22H18FN5O4/c1-3-27-17-16(18(24)29)25-19(12-4-6-13(7-5-12)21(30)32-2)26-20(17)28(22(27)31)15-10-8-14(23)9-11-15/h4-11H,3H2,1-2H3,(H2,24,29) |
| InChIKey | RJABEODRPLHXCQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 122.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |