C23H20FN5O5 — CID 53088278
ethyl 2-[6-carbamoyl-9-(4-fluorophenyl)-2-(2-methoxyphenyl)-8-oxopurin-7-yl]acetate (PubChem CID 53088278) has the molecular formula C23H20FN5O5 and a molecular weight of 465.44 g/mol. Its IUPAC name is ethyl 2-[6-carbamoyl-9-(4-fluorophenyl)-2-(2-methoxyphenyl)-8-oxopurin-7-yl]acetate.
| Compound Name | ethyl 2-[6-carbamoyl-9-(4-fluorophenyl)-2-(2-methoxyphenyl)-8-oxopurin-7-yl]acetate |
|---|---|
| PubChem CID | 53088278 |
| Molecular Formula | C23H20FN5O5 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | ethyl 2-[6-carbamoyl-9-(4-fluorophenyl)-2-(2-methoxyphenyl)-8-oxopurin-7-yl]acetate |
| SMILES | CCOC(=O)Cn1c(=O)n(-c2ccc(F)cc2)c2nc(-c3ccccc3OC)nc(C(N)=O)c21 |
| InChI | InChI=1S/C23H20FN5O5/c1-3-34-17(30)12-28-19-18(20(25)31)26-21(15-6-4-5-7-16(15)33-2)27-22(19)29(23(28)32)14-10-8-13(24)9-11-14/h4-11H,3,12H2,1-2H3,(H2,25,31) |
| InChIKey | CPDJPDYFQYZTQE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |