C25H16F3N5O2 — CID 53008334
7-benzyl-2-(2,3-difluorophenyl)-9-(4-fluorophenyl)-8-oxopurine-6-carboxamide (PubChem CID 53008334) has the molecular formula C25H16F3N5O2 and a molecular weight of 475.43 g/mol. Its IUPAC name is 7-benzyl-2-(2,3-difluorophenyl)-9-(4-fluorophenyl)-8-oxopurine-6-carboxamide.
| Compound Name | 7-benzyl-2-(2,3-difluorophenyl)-9-(4-fluorophenyl)-8-oxopurine-6-carboxamide |
|---|---|
| PubChem CID | 53008334 |
| Molecular Formula | C25H16F3N5O2 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 7-benzyl-2-(2,3-difluorophenyl)-9-(4-fluorophenyl)-8-oxopurine-6-carboxamide |
| SMILES | NC(=O)c1nc(-c2cccc(F)c2F)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H16F3N5O2/c26-15-9-11-16(12-10-15)33-24-21(32(25(33)35)13-14-5-2-1-3-6-14)20(22(29)34)30-23(31-24)17-7-4-8-18(27)19(17)28/h1-12H,13H2,(H2,29,34) |
| InChIKey | CNTFPDPQYMKTDL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |