C29H27N5O2 — CID 53088290
7-benzyl-2-(2,4-dimethylphenyl)-9-(3,4-dimethylphenyl)-8-oxopurine-6-carboxamide (PubChem CID 53088290) has the molecular formula C29H27N5O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is 7-benzyl-2-(2,4-dimethylphenyl)-9-(3,4-dimethylphenyl)-8-oxopurine-6-carboxamide.
| Compound Name | 7-benzyl-2-(2,4-dimethylphenyl)-9-(3,4-dimethylphenyl)-8-oxopurine-6-carboxamide |
|---|---|
| PubChem CID | 53088290 |
| Molecular Formula | C29H27N5O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 7-benzyl-2-(2,4-dimethylphenyl)-9-(3,4-dimethylphenyl)-8-oxopurine-6-carboxamide |
| SMILES | Cc1ccc(-c2nc(C(N)=O)c3c(n2)n(-c2ccc(C)c(C)c2)c(=O)n3Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C29H27N5O2/c1-17-10-13-23(20(4)14-17)27-31-24(26(30)35)25-28(32-27)34(22-12-11-18(2)19(3)15-22)29(36)33(25)16-21-8-6-5-7-9-21/h5-15H,16H2,1-4H3,(H2,30,35) |
| InChIKey | HYLSHNLSDHCKCE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |