About 9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide
9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide (PubChem CID 53088314) has the molecular formula C17H19N5O2
and a molecular weight of 325.37 g/mol. Its IUPAC name is 9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide.
Molecular Properties
| Compound Name | 9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide |
| PubChem CID | 53088314 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide |
| SMILES | CCn1c(=O)n(-c2ccc(C)c(C)c2)c2nc(C)nc(C(N)=O)c21 |
| InChI | InChI=1S/C17H19N5O2/c1-5-21-14-13(15(18)23)19-11(4)20-16(14)22(17(21)24)12-7-6-9(2)10(3)8-12/h6-8H,5H2,1-4H3,(H2,18,23) |
| InChIKey | LMJRBJWTUMQQCT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide?
The IUPAC name of 9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide (CID 53088314) is 9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide.
What is the SMILES notation for 9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide?
The canonical SMILES for 9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide is CCn1c(=O)n(-c2ccc(C)c(C)c2)c2nc(C)nc(C(N)=O)c21.
What is the InChIKey of 9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide?
The InChIKey is LMJRBJWTUMQQCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5O2/c1-5-21-14-13(15(18)23)19-11(4)20-16(14)22(17(21)24)12-7-6-9(2)10(3)8-12/h6-8H,5H2,1-4H3,(H2,18,23).
What are the key properties of 9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide?
9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide has a molecular weight of 325.37 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(3,4-dimethylphenyl)-7-ethyl-2-methyl-8-oxopurine-6-carboxamide is sourced from PubChem (CID 53088314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).