C24H24FN5O3 — CID 53088207
2-(4-butoxyphenyl)-7-ethyl-9-(4-fluorophenyl)-8-oxopurine-6-carboxamide (PubChem CID 53088207) has the molecular formula C24H24FN5O3 and a molecular weight of 449.49 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-7-ethyl-9-(4-fluorophenyl)-8-oxopurine-6-carboxamide.
| Compound Name | 2-(4-butoxyphenyl)-7-ethyl-9-(4-fluorophenyl)-8-oxopurine-6-carboxamide |
|---|---|
| PubChem CID | 53088207 |
| Molecular Formula | C24H24FN5O3 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 2-(4-butoxyphenyl)-7-ethyl-9-(4-fluorophenyl)-8-oxopurine-6-carboxamide |
| SMILES | CCCCOc1ccc(-c2nc(C(N)=O)c3c(n2)n(-c2ccc(F)cc2)c(=O)n3CC)cc1 |
| InChI | InChI=1S/C24H24FN5O3/c1-3-5-14-33-18-12-6-15(7-13-18)22-27-19(21(26)31)20-23(28-22)30(24(32)29(20)4-2)17-10-8-16(25)9-11-17/h6-13H,3-5,14H2,1-2H3,(H2,26,31) |
| InChIKey | CYAOMNBACLHLOL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|