C23H22FN5O3 — CID 53088211
7-ethyl-9-(4-fluorophenyl)-8-oxo-2-(4-propan-2-yloxyphenyl)purine-6-carboxamide (PubChem CID 53088211) has the molecular formula C23H22FN5O3 and a molecular weight of 435.46 g/mol. Its IUPAC name is 7-ethyl-9-(4-fluorophenyl)-8-oxo-2-(4-propan-2-yloxyphenyl)purine-6-carboxamide.
| Compound Name | 7-ethyl-9-(4-fluorophenyl)-8-oxo-2-(4-propan-2-yloxyphenyl)purine-6-carboxamide |
|---|---|
| PubChem CID | 53088211 |
| Molecular Formula | C23H22FN5O3 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 7-ethyl-9-(4-fluorophenyl)-8-oxo-2-(4-propan-2-yloxyphenyl)purine-6-carboxamide |
| SMILES | CCn1c(=O)n(-c2ccc(F)cc2)c2nc(-c3ccc(OC(C)C)cc3)nc(C(N)=O)c21 |
| InChI | InChI=1S/C23H22FN5O3/c1-4-28-19-18(20(25)30)26-21(14-5-11-17(12-6-14)32-13(2)3)27-22(19)29(23(28)31)16-9-7-15(24)8-10-16/h5-13H,4H2,1-3H3,(H2,25,30) |
| InChIKey | BZKVTTVZNMNXQN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |