C27H22FN5O3 — CID 53088184
7-ethyl-9-(4-fluorophenyl)-8-oxo-2-(3-phenylmethoxyphenyl)purine-6-carboxamide (PubChem CID 53088184) has the molecular formula C27H22FN5O3 and a molecular weight of 483.50 g/mol. Its IUPAC name is 7-ethyl-9-(4-fluorophenyl)-8-oxo-2-(3-phenylmethoxyphenyl)purine-6-carboxamide.
| Compound Name | 7-ethyl-9-(4-fluorophenyl)-8-oxo-2-(3-phenylmethoxyphenyl)purine-6-carboxamide |
|---|---|
| PubChem CID | 53088184 |
| Molecular Formula | C27H22FN5O3 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 7-ethyl-9-(4-fluorophenyl)-8-oxo-2-(3-phenylmethoxyphenyl)purine-6-carboxamide |
| SMILES | CCn1c(=O)n(-c2ccc(F)cc2)c2nc(-c3cccc(OCc4ccccc4)c3)nc(C(N)=O)c21 |
| InChI | InChI=1S/C27H22FN5O3/c1-2-32-23-22(24(29)34)30-25(31-26(23)33(27(32)35)20-13-11-19(28)12-14-20)18-9-6-10-21(15-18)36-16-17-7-4-3-5-8-17/h3-15H,2,16H2,1H3,(H2,29,34) |
| InChIKey | BBBHDWVHINPVOX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |