C22H20FN5O4 — CID 53088232
2-(4-ethoxy-3-methoxyphenyl)-9-(4-fluorophenyl)-7-methyl-8-oxopurine-6-carboxamide (PubChem CID 53088232) has the molecular formula C22H20FN5O4 and a molecular weight of 437.43 g/mol. Its IUPAC name is 2-(4-ethoxy-3-methoxyphenyl)-9-(4-fluorophenyl)-7-methyl-8-oxopurine-6-carboxamide.
| Compound Name | 2-(4-ethoxy-3-methoxyphenyl)-9-(4-fluorophenyl)-7-methyl-8-oxopurine-6-carboxamide |
|---|---|
| PubChem CID | 53088232 |
| Molecular Formula | C22H20FN5O4 |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-(4-ethoxy-3-methoxyphenyl)-9-(4-fluorophenyl)-7-methyl-8-oxopurine-6-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C(N)=O)c3c(n2)n(-c2ccc(F)cc2)c(=O)n3C)cc1OC |
| InChI | InChI=1S/C22H20FN5O4/c1-4-32-15-10-5-12(11-16(15)31-3)20-25-17(19(24)29)18-21(26-20)28(22(30)27(18)2)14-8-6-13(23)7-9-14/h5-11H,4H2,1-3H3,(H2,24,29) |
| InChIKey | ULVQYHZSKWVEIG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |