C21H16F3N5O3 — CID 20854886
9-(3-methoxyphenyl)-7-methyl-8-oxo-2-[4-(trifluoromethyl)phenyl]purine-6-carboxamide (PubChem CID 20854886) has the molecular formula C21H16F3N5O3 and a molecular weight of 443.39 g/mol. Its IUPAC name is 9-(3-methoxyphenyl)-7-methyl-8-oxo-2-[4-(trifluoromethyl)phenyl]purine-6-carboxamide.
| Compound Name | 9-(3-methoxyphenyl)-7-methyl-8-oxo-2-[4-(trifluoromethyl)phenyl]purine-6-carboxamide |
|---|---|
| PubChem CID | 20854886 |
| Molecular Formula | C21H16F3N5O3 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 9-(3-methoxyphenyl)-7-methyl-8-oxo-2-[4-(trifluoromethyl)phenyl]purine-6-carboxamide |
| SMILES | COc1cccc(-n2c(=O)n(C)c3c(C(N)=O)nc(-c4ccc(C(F)(F)F)cc4)nc32)c1 |
| InChI | InChI=1S/C21H16F3N5O3/c1-28-16-15(17(25)30)26-18(11-6-8-12(9-7-11)21(22,23)24)27-19(16)29(20(28)31)13-4-3-5-14(10-13)32-2/h3-10H,1-2H3,(H2,25,30) |
| InChIKey | OVAZUXPSZOLCHQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |