C28H25N5O3 — CID 53088289
7-benzyl-9-(3,4-dimethylphenyl)-2-(3-methoxyphenyl)-8-oxopurine-6-carboxamide (PubChem CID 53088289) has the molecular formula C28H25N5O3 and a molecular weight of 479.54 g/mol. Its IUPAC name is 7-benzyl-9-(3,4-dimethylphenyl)-2-(3-methoxyphenyl)-8-oxopurine-6-carboxamide.
| Compound Name | 7-benzyl-9-(3,4-dimethylphenyl)-2-(3-methoxyphenyl)-8-oxopurine-6-carboxamide |
|---|---|
| PubChem CID | 53088289 |
| Molecular Formula | C28H25N5O3 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 7-benzyl-9-(3,4-dimethylphenyl)-2-(3-methoxyphenyl)-8-oxopurine-6-carboxamide |
| SMILES | COc1cccc(-c2nc(C(N)=O)c3c(n2)n(-c2ccc(C)c(C)c2)c(=O)n3Cc2ccccc2)c1 |
| InChI | InChI=1S/C28H25N5O3/c1-17-12-13-21(14-18(17)2)33-27-24(32(28(33)35)16-19-8-5-4-6-9-19)23(25(29)34)30-26(31-27)20-10-7-11-22(15-20)36-3/h4-15H,16H2,1-3H3,(H2,29,34) |
| InChIKey | ZLCGDTIATHMWTB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |