C22H17F2N5O4 — CID 53088263
ethyl 2-[6-carbamoyl-2,9-bis(4-fluorophenyl)-8-oxopurin-7-yl]acetate (PubChem CID 53088263) has the molecular formula C22H17F2N5O4 and a molecular weight of 453.41 g/mol. Its IUPAC name is ethyl 2-[6-carbamoyl-2,9-bis(4-fluorophenyl)-8-oxopurin-7-yl]acetate.
| Compound Name | ethyl 2-[6-carbamoyl-2,9-bis(4-fluorophenyl)-8-oxopurin-7-yl]acetate |
|---|---|
| PubChem CID | 53088263 |
| Molecular Formula | C22H17F2N5O4 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | ethyl 2-[6-carbamoyl-2,9-bis(4-fluorophenyl)-8-oxopurin-7-yl]acetate |
| SMILES | CCOC(=O)Cn1c(=O)n(-c2ccc(F)cc2)c2nc(-c3ccc(F)cc3)nc(C(N)=O)c21 |
| InChI | InChI=1S/C22H17F2N5O4/c1-2-33-16(30)11-28-18-17(19(25)31)26-20(12-3-5-13(23)6-4-12)27-21(18)29(22(28)32)15-9-7-14(24)8-10-15/h3-10H,2,11H2,1H3,(H2,25,31) |
| InChIKey | WPVCJZMUHOMFHG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 122.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |