C27H23N5O5 — CID 16822606
9-(2,4-dimethoxyphenyl)-8-oxo-2-(4-phenylmethoxyphenyl)-7H-purine-6-carboxamide (PubChem CID 16822606) has the molecular formula C27H23N5O5 and a molecular weight of 497.51 g/mol. Its IUPAC name is 9-(2,4-dimethoxyphenyl)-8-oxo-2-(4-phenylmethoxyphenyl)-7H-purine-6-carboxamide.
| Compound Name | 9-(2,4-dimethoxyphenyl)-8-oxo-2-(4-phenylmethoxyphenyl)-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 16822606 |
| Molecular Formula | C27H23N5O5 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 9-(2,4-dimethoxyphenyl)-8-oxo-2-(4-phenylmethoxyphenyl)-7H-purine-6-carboxamide |
| SMILES | COc1ccc(-n2c(=O)[nH]c3c(C(N)=O)nc(-c4ccc(OCc5ccccc5)cc4)nc32)c(OC)c1 |
| InChI | InChI=1S/C27H23N5O5/c1-35-19-12-13-20(21(14-19)36-2)32-26-23(30-27(32)34)22(24(28)33)29-25(31-26)17-8-10-18(11-9-17)37-15-16-6-4-3-5-7-16/h3-14H,15H2,1-2H3,(H2,28,33)(H,30,34) |
| InChIKey | ZVHPPJLKPMNCGO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |