C21H18N6O5 — CID 68895817
[3-[6-carbamoyl-9-(2-methoxyphenyl)-8-oxo-7H-purin-2-yl]phenyl]methylcarbamic acid (PubChem CID 68895817) has the molecular formula C21H18N6O5 and a molecular weight of 434.41 g/mol. Its IUPAC name is [3-[6-carbamoyl-9-(2-methoxyphenyl)-8-oxo-7H-purin-2-yl]phenyl]methylcarbamic acid.
| Compound Name | [3-[6-carbamoyl-9-(2-methoxyphenyl)-8-oxo-7H-purin-2-yl]phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 68895817 |
| Molecular Formula | C21H18N6O5 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [3-[6-carbamoyl-9-(2-methoxyphenyl)-8-oxo-7H-purin-2-yl]phenyl]methylcarbamic acid |
| SMILES | COc1ccccc1-n1c(=O)[nH]c2c(C(N)=O)nc(-c3cccc(CNC(=O)O)c3)nc21 |
| InChI | InChI=1S/C21H18N6O5/c1-32-14-8-3-2-7-13(14)27-19-16(25-20(27)29)15(17(22)28)24-18(26-19)12-6-4-5-11(9-12)10-23-21(30)31/h2-9,23H,10H2,1H3,(H2,22,28)(H,25,29)(H,30,31) |
| InChIKey | WJWRGBUTLSZKOI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |