C20H17N5O4 — CID 135734255
2-(3-ethoxy-2-hydroxyphenyl)-8-oxo-9-phenyl-7H-purine-6-carboxamide (PubChem CID 135734255) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is 2-(3-ethoxy-2-hydroxyphenyl)-8-oxo-9-phenyl-7H-purine-6-carboxamide.
| Compound Name | 2-(3-ethoxy-2-hydroxyphenyl)-8-oxo-9-phenyl-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 135734255 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-(3-ethoxy-2-hydroxyphenyl)-8-oxo-9-phenyl-7H-purine-6-carboxamide |
| SMILES | CCOc1cccc(-c2nc(C(N)=O)c3[nH]c(=O)n(-c4ccccc4)c3n2)c1O |
| InChI | InChI=1S/C20H17N5O4/c1-2-29-13-10-6-9-12(16(13)26)18-22-14(17(21)27)15-19(24-18)25(20(28)23-15)11-7-4-3-5-8-11/h3-10,26H,2H2,1H3,(H2,21,27)(H,23,28) |
| InChIKey | YMXWDKVZHCUZEG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |