C26H19N5O4 — CID 130339985
methyl 3-[6-carbamoyl-8-oxo-2-(4-phenylphenyl)-7H-purin-9-yl]benzoate (PubChem CID 130339985) has the molecular formula C26H19N5O4 and a molecular weight of 465.47 g/mol. Its IUPAC name is methyl 3-[6-carbamoyl-8-oxo-2-(4-phenylphenyl)-7H-purin-9-yl]benzoate.
| Compound Name | methyl 3-[6-carbamoyl-8-oxo-2-(4-phenylphenyl)-7H-purin-9-yl]benzoate |
|---|---|
| PubChem CID | 130339985 |
| Molecular Formula | C26H19N5O4 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | methyl 3-[6-carbamoyl-8-oxo-2-(4-phenylphenyl)-7H-purin-9-yl]benzoate |
| SMILES | COC(=O)c1cccc(-n2c(=O)[nH]c3c(C(N)=O)nc(-c4ccc(-c5ccccc5)cc4)nc32)c1 |
| InChI | InChI=1S/C26H19N5O4/c1-35-25(33)18-8-5-9-19(14-18)31-24-21(29-26(31)34)20(22(27)32)28-23(30-24)17-12-10-16(11-13-17)15-6-3-2-4-7-15/h2-14H,1H3,(H2,27,32)(H,29,34) |
| InChIKey | OINSHNRUDJNCQG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |