C12H9N5O3 — CID 15741988
3-[(4-nitrophenyl)methyl]-7H-purin-6-one (PubChem CID 15741988) has the molecular formula C12H9N5O3 and a molecular weight of 271.24 g/mol. Its IUPAC name is 3-[(4-nitrophenyl)methyl]-7H-purin-6-one.
| Compound Name | 3-[(4-nitrophenyl)methyl]-7H-purin-6-one |
|---|---|
| PubChem CID | 15741988 |
| Molecular Formula | C12H9N5O3 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 3-[(4-nitrophenyl)methyl]-7H-purin-6-one |
| SMILES | O=c1ncn(Cc2ccc([N+](=O)[O-])cc2)c2nc[nH]c12 |
| InChI | InChI=1S/C12H9N5O3/c18-12-10-11(14-6-13-10)16(7-15-12)5-8-1-3-9(4-2-8)17(19)20/h1-4,6-7H,5H2,(H,13,14) |
| InChIKey | NBDPSSNQSHELQR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|