C17H9Cl4N9O2 — CID 158097191
2,6-dichloro-9-[(4-nitrophenyl)methyl]purine;2,6-dichloro-7H-purine (PubChem CID 158097191) has the molecular formula C17H9Cl4N9O2 and a molecular weight of 513.13 g/mol. Its IUPAC name is 2,6-dichloro-9-[(4-nitrophenyl)methyl]purine;2,6-dichloro-7H-purine.
| Compound Name | 2,6-dichloro-9-[(4-nitrophenyl)methyl]purine;2,6-dichloro-7H-purine |
|---|---|
| PubChem CID | 158097191 |
| Molecular Formula | C17H9Cl4N9O2 |
| Molecular Weight | 513.13 g/mol |
| Exact Mass | 510.96 |
| IUPAC Name | 2,6-dichloro-9-[(4-nitrophenyl)methyl]purine;2,6-dichloro-7H-purine |
| SMILES | Clc1nc(Cl)c2[nH]cnc2n1.O=[N+]([O-])c1ccc(Cn2cnc3c(Cl)nc(Cl)nc32)cc1 |
| InChI | InChI=1S/C12H7Cl2N5O2.C5H2Cl2N4/c13-10-9-11(17-12(14)16-10)18(6-15-9)5-7-1-3-8(4-2-7)19(20)21;6-3-2-4(9-1-8-2)11-5(7)10-3/h1-4,6H,5H2;1H,(H,8,9,10,11) |
| InChIKey | FOUUSDUDIGUXOK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 141.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.13 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|