C5H2Cl2N4 — CID 10750289
2,6-dichloro-7H-purine (PubChem CID 10750289) has the molecular formula C5H2Cl2N4 and a molecular weight of 192.98 g/mol. Its IUPAC name is 2,6-dichloro-7H-purine.
| Compound Name | 2,6-dichloro-7H-purine |
|---|---|
| PubChem CID | 10750289 |
| Molecular Formula | C5H2Cl2N4 |
| Molecular Weight | 192.98 g/mol |
| Exact Mass | 191.96 |
| IUPAC Name | 2,6-dichloro-7H-purine |
| SMILES | Clc1[15n]c(Cl)c2[15nH][13cH]nc2[15n]1 |
| InChI | InChI=1S/C5H2Cl2N4/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H,8,9,10,11)/i1+1,8+1,10+1,11+1 |
| InChIKey | RMFWVOLULURGJI-QWLJVSGLSA-N |
| XLogP | 1.66 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.98 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |