C12H9N5O3S — CID 135577997
3-methylsulfanyl-1-(4-nitrophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135577997) has the molecular formula C12H9N5O3S and a molecular weight of 303.30 g/mol. Its IUPAC name is 3-methylsulfanyl-1-(4-nitrophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 3-methylsulfanyl-1-(4-nitrophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135577997 |
| Molecular Formula | C12H9N5O3S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 3-methylsulfanyl-1-(4-nitrophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CSc1nn(-c2ccc([N+](=O)[O-])cc2)c2nc[nH]c(=O)c12 |
| InChI | InChI=1S/C12H9N5O3S/c1-21-12-9-10(13-6-14-11(9)18)16(15-12)7-2-4-8(5-3-7)17(19)20/h2-6H,1H3,(H,13,14,18) |
| InChIKey | UIIDBFRCWYYMKD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|