C11H6N6O5 — CID 137234356
7-nitro-1-(4-nitrophenyl)-5H-triazolo[4,5-c]pyridin-4-one (PubChem CID 137234356) has the molecular formula C11H6N6O5 and a molecular weight of 302.21 g/mol. Its IUPAC name is 7-nitro-1-(4-nitrophenyl)-5H-triazolo[4,5-c]pyridin-4-one.
| Compound Name | 7-nitro-1-(4-nitrophenyl)-5H-triazolo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 137234356 |
| Molecular Formula | C11H6N6O5 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 7-nitro-1-(4-nitrophenyl)-5H-triazolo[4,5-c]pyridin-4-one |
| SMILES | O=c1[nH]cc([N+](=O)[O-])c2c1nnn2-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H6N6O5/c18-11-9-10(8(5-12-11)17(21)22)15(14-13-9)6-1-3-7(4-2-6)16(19)20/h1-5H,(H,12,18) |
| InChIKey | INCVUEQARZWJBN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 149.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|