C14H14N4O3 — CID 15004629
6,6-dimethyl-1-(4-nitrophenyl)-5,7-dihydrobenzotriazol-4-one (PubChem CID 15004629) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 6,6-dimethyl-1-(4-nitrophenyl)-5,7-dihydrobenzotriazol-4-one.
| Compound Name | 6,6-dimethyl-1-(4-nitrophenyl)-5,7-dihydrobenzotriazol-4-one |
|---|---|
| PubChem CID | 15004629 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 6,6-dimethyl-1-(4-nitrophenyl)-5,7-dihydrobenzotriazol-4-one |
| SMILES | CC1(C)CC(=O)c2nnn(-c3ccc([N+](=O)[O-])cc3)c2C1 |
| InChI | InChI=1S/C14H14N4O3/c1-14(2)7-11-13(12(19)8-14)15-16-17(11)9-3-5-10(6-4-9)18(20)21/h3-6H,7-8H2,1-2H3 |
| InChIKey | QNJSHNRJNHQLRV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|