C18H16N6O2 — CID 15169142
4-(4,5-dihydro-1H-imidazol-2-yl)-5-(4-methylphenyl)-1-(4-nitrophenyl)triazole (PubChem CID 15169142) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 4-(4,5-dihydro-1H-imidazol-2-yl)-5-(4-methylphenyl)-1-(4-nitrophenyl)triazole.
| Compound Name | 4-(4,5-dihydro-1H-imidazol-2-yl)-5-(4-methylphenyl)-1-(4-nitrophenyl)triazole |
|---|---|
| PubChem CID | 15169142 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 4-(4,5-dihydro-1H-imidazol-2-yl)-5-(4-methylphenyl)-1-(4-nitrophenyl)triazole |
| SMILES | Cc1ccc(-c2c(C3=NCCN3)nnn2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H16N6O2/c1-12-2-4-13(5-3-12)17-16(18-19-10-11-20-18)21-22-23(17)14-6-8-15(9-7-14)24(25)26/h2-9H,10-11H2,1H3,(H,19,20) |
| InChIKey | QWIFLJPYRXUTLK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|