C26H31N4O2P — CID 58856385
dicyclohexyl-[5-(4-nitrophenyl)-1-phenyltriazol-4-yl]phosphane (PubChem CID 58856385) has the molecular formula C26H31N4O2P and a molecular weight of 462.53 g/mol. Its IUPAC name is dicyclohexyl-[5-(4-nitrophenyl)-1-phenyltriazol-4-yl]phosphane.
| Compound Name | dicyclohexyl-[5-(4-nitrophenyl)-1-phenyltriazol-4-yl]phosphane |
|---|---|
| PubChem CID | 58856385 |
| Molecular Formula | C26H31N4O2P |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | dicyclohexyl-[5-(4-nitrophenyl)-1-phenyltriazol-4-yl]phosphane |
| SMILES | O=[N+]([O-])c1ccc(-c2c(P(C3CCCCC3)C3CCCCC3)nnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H31N4O2P/c31-30(32)22-18-16-20(17-19-22)25-26(27-28-29(25)21-10-4-1-5-11-21)33(23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1,4-5,10-11,16-19,23-24H,2-3,6-9,12-15H2 |
| InChIKey | XWBRARCXXLSQIN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|