About cyclohexane;ethene;nitrobenzene
cyclohexane;ethene;nitrobenzene (PubChem CID 174971101) has the molecular formula C18H29NO2
and a molecular weight of 291.44 g/mol. Its IUPAC name is cyclohexane;ethene;nitrobenzene.
Molecular Properties
| Compound Name | cyclohexane;ethene;nitrobenzene |
| PubChem CID | 174971101 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | cyclohexane;ethene;nitrobenzene |
| SMILES | C1CCCCC1.C=C.C=C.C=C.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.C6H12.3C2H4/c8-7(9)6-4-2-1-3-5-6;1-2-4-6-5-3-1;3*1-2/h1-5H;1-6H2;3*1-2H2 |
| InChIKey | NQKJHYAKVMQBKD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane;ethene;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;ethene;nitrobenzene?
The IUPAC name of cyclohexane;ethene;nitrobenzene (CID 174971101) is cyclohexane;ethene;nitrobenzene.
What is the SMILES notation for cyclohexane;ethene;nitrobenzene?
The canonical SMILES for cyclohexane;ethene;nitrobenzene is C1CCCCC1.C=C.C=C.C=C.O=[N+]([O-])c1ccccc1.
What is the InChIKey of cyclohexane;ethene;nitrobenzene?
The InChIKey is NQKJHYAKVMQBKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C6H12.3C2H4/c8-7(9)6-4-2-1-3-5-6;1-2-4-6-5-3-1;3*1-2/h1-5H;1-6H2;3*1-2H2.
What are the key properties of cyclohexane;ethene;nitrobenzene?
cyclohexane;ethene;nitrobenzene has a molecular weight of 291.44 g/mol, XLogP of 6.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;ethene;nitrobenzene is sourced from PubChem (CID 174971101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).