C10H9ClN4O3 — CID 12786139
3-(4,5-dihydro-1H-imidazol-2-yl)-6-nitro-1,2-benzoxazole;hydrochloride (PubChem CID 12786139) has the molecular formula C10H9ClN4O3 and a molecular weight of 268.66 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-yl)-6-nitro-1,2-benzoxazole;hydrochloride.
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-yl)-6-nitro-1,2-benzoxazole;hydrochloride |
|---|---|
| PubChem CID | 12786139 |
| Molecular Formula | C10H9ClN4O3 |
| Molecular Weight | 268.66 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-yl)-6-nitro-1,2-benzoxazole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2c(C3=NCCN3)noc2c1 |
| InChI | InChI=1S/C10H8N4O3.ClH/c15-14(16)6-1-2-7-8(5-6)17-13-9(7)10-11-3-4-12-10;/h1-2,5H,3-4H2,(H,11,12);1H |
| InChIKey | BMFOVTTUJDYMHE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.66 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|