C17H13N3O3 — CID 22083529
2-[4-(3-nitrophenyl)-1-benzofuran-2-yl]-4,5-dihydro-1H-imidazole (PubChem CID 22083529) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-[4-(3-nitrophenyl)-1-benzofuran-2-yl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[4-(3-nitrophenyl)-1-benzofuran-2-yl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 22083529 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-[4-(3-nitrophenyl)-1-benzofuran-2-yl]-4,5-dihydro-1H-imidazole |
| SMILES | O=[N+]([O-])c1cccc(-c2cccc3oc(C4=NCCN4)cc23)c1 |
| InChI | InChI=1S/C17H13N3O3/c21-20(22)12-4-1-3-11(9-12)13-5-2-6-15-14(13)10-16(23-15)17-18-7-8-19-17/h1-6,9-10H,7-8H2,(H,18,19) |
| InChIKey | HHQHLGLWTLTIAE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|