C16H15N3O3 — CID 59615691
2-[4-(2-methoxy-3-nitrophenyl)phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 59615691) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[4-(2-methoxy-3-nitrophenyl)phenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[4-(2-methoxy-3-nitrophenyl)phenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 59615691 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[4-(2-methoxy-3-nitrophenyl)phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | COc1c(-c2ccc(C3=NCCN3)cc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15N3O3/c1-22-15-13(3-2-4-14(15)19(20)21)11-5-7-12(8-6-11)16-17-9-10-18-16/h2-8H,9-10H2,1H3,(H,17,18) |
| InChIKey | WWXGIYUDHVOOOL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|