C15H14N4O3 — CID 82252016
3-(4,5-dihydro-1H-imidazol-2-yl)-2-[(2-nitrophenyl)methoxy]pyridine (PubChem CID 82252016) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-yl)-2-[(2-nitrophenyl)methoxy]pyridine.
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-yl)-2-[(2-nitrophenyl)methoxy]pyridine |
|---|---|
| PubChem CID | 82252016 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-yl)-2-[(2-nitrophenyl)methoxy]pyridine |
| SMILES | O=[N+]([O-])c1ccccc1COc1ncccc1C1=NCCN1 |
| InChI | InChI=1S/C15H14N4O3/c20-19(21)13-6-2-1-4-11(13)10-22-15-12(5-3-7-18-15)14-16-8-9-17-14/h1-7H,8-10H2,(H,16,17) |
| InChIKey | XTJWTEFGYBXEEK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|