C10H11N3O2 — CID 10330581
2-[(2-nitrophenyl)methyl]-4,5-dihydro-1H-imidazole (PubChem CID 10330581) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-[(2-nitrophenyl)methyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[(2-nitrophenyl)methyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 10330581 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-[(2-nitrophenyl)methyl]-4,5-dihydro-1H-imidazole |
| SMILES | O=[N+]([O-])c1ccccc1CC1=NCCN1 |
| InChI | InChI=1S/C10H11N3O2/c14-13(15)9-4-2-1-3-8(9)7-10-11-5-6-12-10/h1-4H,5-7H2,(H,11,12) |
| InChIKey | KAUSKTOYDDNFCR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|