C9H8N4O3 — CID 135667644
3-[(2-nitrophenyl)methyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 135667644) has the molecular formula C9H8N4O3 and a molecular weight of 220.19 g/mol. Its IUPAC name is 3-[(2-nitrophenyl)methyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[(2-nitrophenyl)methyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 135667644 |
| Molecular Formula | C9H8N4O3 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 3-[(2-nitrophenyl)methyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(Cc2ccccc2[N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C9H8N4O3/c14-9-10-8(11-12-9)5-6-3-1-2-4-7(6)13(15)16/h1-4H,5H2,(H2,10,11,12,14) |
| InChIKey | RWALGXNMKVIWJC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|