C11H12N4O5 — CID 44661110
azanium 5-[(2-nitrophenyl)methyl]-2,4-dioxo-1H-pyrimidin-6-olate (PubChem CID 44661110) has the molecular formula C11H12N4O5 and a molecular weight of 280.24 g/mol. Its IUPAC name is azanium 5-[(2-nitrophenyl)methyl]-2,4-dioxo-1H-pyrimidin-6-olate.
| Compound Name | azanium 5-[(2-nitrophenyl)methyl]-2,4-dioxo-1H-pyrimidin-6-olate |
|---|---|
| PubChem CID | 44661110 |
| Molecular Formula | C11H12N4O5 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | azanium 5-[(2-nitrophenyl)methyl]-2,4-dioxo-1H-pyrimidin-6-olate |
| SMILES | O=c1[nH]c([O-])c(Cc2ccccc2[N+](=O)[O-])c(=O)[nH]1.[NH4+] |
| InChI | InChI=1S/C11H9N3O5.H3N/c15-9-7(10(16)13-11(17)12-9)5-6-3-1-2-4-8(6)14(18)19;/h1-4H,5H2,(H3,12,13,15,16,17);1H3 |
| InChIKey | HMIBQOOWGNEDPA-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 168.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|