C16H12N4O3 — CID 11500517
5-[(2-nitrophenyl)methyl]-3-phenyl-1H-1,2,4-triazin-6-one (PubChem CID 11500517) has the molecular formula C16H12N4O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is 5-[(2-nitrophenyl)methyl]-3-phenyl-1H-1,2,4-triazin-6-one.
| Compound Name | 5-[(2-nitrophenyl)methyl]-3-phenyl-1H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 11500517 |
| Molecular Formula | C16H12N4O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-[(2-nitrophenyl)methyl]-3-phenyl-1H-1,2,4-triazin-6-one |
| SMILES | O=c1[nH]nc(-c2ccccc2)nc1Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12N4O3/c21-16-13(10-12-8-4-5-9-14(12)20(22)23)17-15(18-19-16)11-6-2-1-3-7-11/h1-9H,10H2,(H,19,21) |
| InChIKey | SEMVBZNUDGGVCC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|