C16H21N7O3 — CID 136923023
3-[4-(2-aminoethyl)piperazin-1-yl]-6-[(2-nitrophenyl)methyl]-4H-1,2,4-triazin-5-one (PubChem CID 136923023) has the molecular formula C16H21N7O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 3-[4-(2-aminoethyl)piperazin-1-yl]-6-[(2-nitrophenyl)methyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[4-(2-aminoethyl)piperazin-1-yl]-6-[(2-nitrophenyl)methyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136923023 |
| Molecular Formula | C16H21N7O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 3-[4-(2-aminoethyl)piperazin-1-yl]-6-[(2-nitrophenyl)methyl]-4H-1,2,4-triazin-5-one |
| SMILES | NCCN1CCN(c2nnc(Cc3ccccc3[N+](=O)[O-])c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C16H21N7O3/c17-5-6-21-7-9-22(10-8-21)16-18-15(24)13(19-20-16)11-12-3-1-2-4-14(12)23(25)26/h1-4H,5-11,17H2,(H,18,20,24) |
| InChIKey | MBWOCHUELYUUCZ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 134.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|