C15H10N4O2 — CID 582148
2-nitro-4,6-diphenyl-1,3,5-triazine (PubChem CID 582148) has the molecular formula C15H10N4O2 and a molecular weight of 278.27 g/mol. Its IUPAC name is 2-nitro-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-nitro-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 582148 |
| Molecular Formula | C15H10N4O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-nitro-4,6-diphenyl-1,3,5-triazine |
| SMILES | O=[N+]([O-])c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H10N4O2/c20-19(21)15-17-13(11-7-3-1-4-8-11)16-14(18-15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | SUZNEURBUBRBCA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|