C22H15N5O3 — CID 67395805
3-[(2-nitrophenyl)methyl]-5-phenyl-2H-pyrazolo[4,3-c][1,8]naphthyridin-4-one (PubChem CID 67395805) has the molecular formula C22H15N5O3 and a molecular weight of 397.39 g/mol. Its IUPAC name is 3-[(2-nitrophenyl)methyl]-5-phenyl-2H-pyrazolo[4,3-c][1,8]naphthyridin-4-one.
| Compound Name | 3-[(2-nitrophenyl)methyl]-5-phenyl-2H-pyrazolo[4,3-c][1,8]naphthyridin-4-one |
|---|---|
| PubChem CID | 67395805 |
| Molecular Formula | C22H15N5O3 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 3-[(2-nitrophenyl)methyl]-5-phenyl-2H-pyrazolo[4,3-c][1,8]naphthyridin-4-one |
| SMILES | O=c1c2c(Cc3ccccc3[N+](=O)[O-])[nH]nc2c2cccnc2n1-c1ccccc1 |
| InChI | InChI=1S/C22H15N5O3/c28-22-19-17(13-14-7-4-5-11-18(14)27(29)30)24-25-20(19)16-10-6-12-23-21(16)26(22)15-8-2-1-3-9-15/h1-12H,13H2,(H,24,25) |
| InChIKey | BFEHBIXKDYTLDR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|