C21H27NO2 — CID 159565543
1,3-bis(2-methylpropyl)-2-[(2-nitrophenyl)methyl]benzene (PubChem CID 159565543) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 1,3-bis(2-methylpropyl)-2-[(2-nitrophenyl)methyl]benzene.
| Compound Name | 1,3-bis(2-methylpropyl)-2-[(2-nitrophenyl)methyl]benzene |
|---|---|
| PubChem CID | 159565543 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 1,3-bis(2-methylpropyl)-2-[(2-nitrophenyl)methyl]benzene |
| SMILES | CC(C)Cc1cccc(CC(C)C)c1Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H27NO2/c1-15(2)12-17-9-7-10-18(13-16(3)4)20(17)14-19-8-5-6-11-21(19)22(23)24/h5-11,15-16H,12-14H2,1-4H3 |
| InChIKey | OIZVISLVCHQEPU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|