C23H22ClN3O3 — CID 22083517
2-[3-butoxy-4-chloro-7-(3-nitrophenyl)naphthalen-2-yl]-4,5-dihydro-1H-imidazole (PubChem CID 22083517) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is 2-[3-butoxy-4-chloro-7-(3-nitrophenyl)naphthalen-2-yl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[3-butoxy-4-chloro-7-(3-nitrophenyl)naphthalen-2-yl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 22083517 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 2-[3-butoxy-4-chloro-7-(3-nitrophenyl)naphthalen-2-yl]-4,5-dihydro-1H-imidazole |
| SMILES | CCCCOc1c(C2=NCCN2)cc2cc(-c3cccc([N+](=O)[O-])c3)ccc2c1Cl |
| InChI | InChI=1S/C23H22ClN3O3/c1-2-3-11-30-22-20(23-25-9-10-26-23)14-17-12-16(7-8-19(17)21(22)24)15-5-4-6-18(13-15)27(28)29/h4-8,12-14H,2-3,9-11H2,1H3,(H,25,26) |
| InChIKey | KDFWJEIOGKBYNC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|