C22H22ClN3O4 — CID 18476254
2-[3-(2-methoxyethoxy)-4-(3-nitrophenyl)naphthalen-2-yl]-4,5-dihydro-1H-imidazole;hydrochloride (PubChem CID 18476254) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is 2-[3-(2-methoxyethoxy)-4-(3-nitrophenyl)naphthalen-2-yl]-4,5-dihydro-1H-imidazole;hydrochloride.
| Compound Name | 2-[3-(2-methoxyethoxy)-4-(3-nitrophenyl)naphthalen-2-yl]-4,5-dihydro-1H-imidazole;hydrochloride |
|---|---|
| PubChem CID | 18476254 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-[3-(2-methoxyethoxy)-4-(3-nitrophenyl)naphthalen-2-yl]-4,5-dihydro-1H-imidazole;hydrochloride |
| SMILES | COCCOc1c(C2=NCCN2)cc2ccccc2c1-c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C22H21N3O4.ClH/c1-28-11-12-29-21-19(22-23-9-10-24-22)14-15-5-2-3-8-18(15)20(21)16-6-4-7-17(13-16)25(26)27;/h2-8,13-14H,9-12H2,1H3,(H,23,24);1H |
| InChIKey | SKCMCVXEMUJZPN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|