C19H19N3O7 — CID 16757183
2-[(1S)-1-[2-(3-nitrophenyl)phenoxy]ethyl]-4,5-dihydro-1H-imidazole;oxalic acid (PubChem CID 16757183) has the molecular formula C19H19N3O7 and a molecular weight of 401.38 g/mol. Its IUPAC name is 2-[(1S)-1-[2-(3-nitrophenyl)phenoxy]ethyl]-4,5-dihydro-1H-imidazole;oxalic acid.
| Compound Name | 2-[(1S)-1-[2-(3-nitrophenyl)phenoxy]ethyl]-4,5-dihydro-1H-imidazole;oxalic acid |
|---|---|
| PubChem CID | 16757183 |
| Molecular Formula | C19H19N3O7 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-[(1S)-1-[2-(3-nitrophenyl)phenoxy]ethyl]-4,5-dihydro-1H-imidazole;oxalic acid |
| SMILES | C[C@H](Oc1ccccc1-c1cccc([N+](=O)[O-])c1)C1=NCCN1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H17N3O3.C2H2O4/c1-12(17-18-9-10-19-17)23-16-8-3-2-7-15(16)13-5-4-6-14(11-13)20(21)22;3-1(4)2(5)6/h2-8,11-12H,9-10H2,1H3,(H,18,19);(H,3,4)(H,5,6)/t12-;/m0./s1 |
| InChIKey | QEAVQZOJQONCSF-YDALLXLXSA-N |
| XLogP | 2.19 |
| TPSA | 151.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|