C35H39N3O5 — CID 141380702
4-(2-dodecan-4-yloxyphenyl)-2,6-bis(3-nitrophenyl)pyridine (PubChem CID 141380702) has the molecular formula C35H39N3O5 and a molecular weight of 581.71 g/mol. Its IUPAC name is 4-(2-dodecan-4-yloxyphenyl)-2,6-bis(3-nitrophenyl)pyridine.
| Compound Name | 4-(2-dodecan-4-yloxyphenyl)-2,6-bis(3-nitrophenyl)pyridine |
|---|---|
| PubChem CID | 141380702 |
| Molecular Formula | C35H39N3O5 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | 4-(2-dodecan-4-yloxyphenyl)-2,6-bis(3-nitrophenyl)pyridine |
| SMILES | CCCCCCCCC(CCC)Oc1ccccc1-c1cc(-c2cccc([N+](=O)[O-])c2)nc(-c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C35H39N3O5/c1-3-5-6-7-8-9-19-31(14-4-2)43-35-21-11-10-20-32(35)28-24-33(26-15-12-17-29(22-26)37(39)40)36-34(25-28)27-16-13-18-30(23-27)38(41)42/h10-13,15-18,20-25,31H,3-9,14,19H2,1-2H3 |
| InChIKey | RNXHPMXHBZBHOR-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 108.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|