C23H19F3N4O4 — CID 102436223
ethyl 4-methyl-6-(4-nitrophenyl)-1-[4-(trifluoromethyl)phenyl]-6,7-dihydrobenzotriazole-5-carboxylate (PubChem CID 102436223) has the molecular formula C23H19F3N4O4 and a molecular weight of 472.42 g/mol. Its IUPAC name is ethyl 4-methyl-6-(4-nitrophenyl)-1-[4-(trifluoromethyl)phenyl]-6,7-dihydrobenzotriazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-6-(4-nitrophenyl)-1-[4-(trifluoromethyl)phenyl]-6,7-dihydrobenzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 102436223 |
| Molecular Formula | C23H19F3N4O4 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | ethyl 4-methyl-6-(4-nitrophenyl)-1-[4-(trifluoromethyl)phenyl]-6,7-dihydrobenzotriazole-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)c2nnn(-c3ccc(C(F)(F)F)cc3)c2CC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H19F3N4O4/c1-3-34-22(31)20-13(2)21-19(12-18(20)14-4-8-17(9-5-14)30(32)33)29(28-27-21)16-10-6-15(7-11-16)23(24,25)26/h4-11,18H,3,12H2,1-2H3 |
| InChIKey | VUZGJGBYEYHNEC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|