C21H22F3N3O4 — CID 11201435
ethyl (4S,9S)-5,5,6-trimethyl-9-(4-nitrophenyl)-2-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate (PubChem CID 11201435) has the molecular formula C21H22F3N3O4 and a molecular weight of 437.42 g/mol. Its IUPAC name is ethyl (4S,9S)-5,5,6-trimethyl-9-(4-nitrophenyl)-2-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate.
| Compound Name | ethyl (4S,9S)-5,5,6-trimethyl-9-(4-nitrophenyl)-2-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate |
|---|---|
| PubChem CID | 11201435 |
| Molecular Formula | C21H22F3N3O4 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | ethyl (4S,9S)-5,5,6-trimethyl-9-(4-nitrophenyl)-2-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C(F)(F)F)N2[C@H](c3ccc([N+](=O)[O-])cc3)CC3=C(C)C(C)(C)[C@@H]1N32 |
| InChI | InChI=1S/C21H22F3N3O4/c1-5-31-19(28)16-17-20(3,4)11(2)14-10-15(12-6-8-13(9-7-12)27(29)30)26(25(14)17)18(16)21(22,23)24/h6-9,15,17H,5,10H2,1-4H3/t15-,17+/m0/s1 |
| InChIKey | YAJAEIBYZQWTMX-DOTOQJQBSA-N |
| XLogP | 4.63 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|