C21H23N3O6 — CID 102207240
dimethyl (4S,9S)-5,5,6-trimethyl-9-(4-nitrophenyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate (PubChem CID 102207240) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is dimethyl (4S,9S)-5,5,6-trimethyl-9-(4-nitrophenyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate.
| Compound Name | dimethyl (4S,9S)-5,5,6-trimethyl-9-(4-nitrophenyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102207240 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | dimethyl (4S,9S)-5,5,6-trimethyl-9-(4-nitrophenyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2[C@H](c3ccc([N+](=O)[O-])cc3)CC3=C(C)C(C)(C)[C@@H]1N32 |
| InChI | InChI=1S/C21H23N3O6/c1-11-14-10-15(12-6-8-13(9-7-12)24(27)28)22-17(20(26)30-5)16(19(25)29-4)18(23(14)22)21(11,2)3/h6-9,15,18H,10H2,1-5H3/t15-,18+/m0/s1 |
| InChIKey | AAVBJECPJCXRNM-MAUKXSAKSA-N |
| XLogP | 2.85 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|