C26H20N2O7 — CID 53343310
dimethyl (2R,13bR)-2-(4-nitrophenyl)-2,13b-dihydro-[1,3]oxazino[3,2-f]phenanthridine-3,4-dicarboxylate (PubChem CID 53343310) has the molecular formula C26H20N2O7 and a molecular weight of 472.45 g/mol. Its IUPAC name is dimethyl (2R,13bR)-2-(4-nitrophenyl)-2,13b-dihydro-[1,3]oxazino[3,2-f]phenanthridine-3,4-dicarboxylate.
| Compound Name | dimethyl (2R,13bR)-2-(4-nitrophenyl)-2,13b-dihydro-[1,3]oxazino[3,2-f]phenanthridine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 53343310 |
| Molecular Formula | C26H20N2O7 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | dimethyl (2R,13bR)-2-(4-nitrophenyl)-2,13b-dihydro-[1,3]oxazino[3,2-f]phenanthridine-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2c3ccccc3-c3ccccc3[C@H]2O[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H20N2O7/c1-33-25(29)21-22(26(30)34-2)27-20-10-6-5-8-18(20)17-7-3-4-9-19(17)24(27)35-23(21)15-11-13-16(14-12-15)28(31)32/h3-14,23-24H,1-2H3/t23-,24-/m1/s1 |
| InChIKey | SQQSNDSDRRPWPF-DNQXCXABSA-N |
| XLogP | 4.45 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|