C20H16N2O3 — CID 11110369
(9S,10S)-10-(4-nitroanilino)-9,10-dihydrophenanthren-9-ol (PubChem CID 11110369) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is (9S,10S)-10-(4-nitroanilino)-9,10-dihydrophenanthren-9-ol.
| Compound Name | (9S,10S)-10-(4-nitroanilino)-9,10-dihydrophenanthren-9-ol |
|---|---|
| PubChem CID | 11110369 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (9S,10S)-10-(4-nitroanilino)-9,10-dihydrophenanthren-9-ol |
| SMILES | O=[N+]([O-])c1ccc(N[C@H]2c3ccccc3-c3ccccc3[C@@H]2O)cc1 |
| InChI | InChI=1S/C20H16N2O3/c23-20-18-8-4-2-6-16(18)15-5-1-3-7-17(15)19(20)21-13-9-11-14(12-10-13)22(24)25/h1-12,19-21,23H/t19-,20-/m0/s1 |
| InChIKey | ROZBNRAWJUNORN-PMACEKPBSA-N |
| XLogP | 4.46 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|